C29H46O4S3 — CID 10951812
(2R,3S,6R,8S,9R)-2-[(2S)-1-(benzenesulfonyl)propan-2-yl]-3,9-dimethyl-8-[(3S)-3-(2-methyl-1,3-dithian-2-yl)butyl]-1,7-dioxaspiro[5.5]undecane (PubChem CID 10951812) has the molecular formula C29H46O4S3 and a molecular weight of 554.88 g/mol. Its IUPAC name is (2R,3S,6R,8S,9R)-2-[(2S)-1-(benzenesulfonyl)propan-2-yl]-3,9-dimethyl-8-[(3S)-3-(2-methyl-1,3-dithian-2-yl)butyl]-1,7-dioxaspiro[5.5]undecane.
| Compound Name | (2R,3S,6R,8S,9R)-2-[(2S)-1-(benzenesulfonyl)propan-2-yl]-3,9-dimethyl-8-[(3S)-3-(2-methyl-1,3-dithian-2-yl)butyl]-1,7-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 10951812 |
| Molecular Formula | C29H46O4S3 |
| Molecular Weight | 554.88 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | (2R,3S,6R,8S,9R)-2-[(2S)-1-(benzenesulfonyl)propan-2-yl]-3,9-dimethyl-8-[(3S)-3-(2-methyl-1,3-dithian-2-yl)butyl]-1,7-dioxaspiro[5.5]undecane |
| SMILES | C[C@H](CS(=O)(=O)c1ccccc1)[C@@H]1O[C@]2(CC[C@@H](C)[C@H](CC[C@H](C)C3(C)SCCCS3)O2)CC[C@@H]1C |
| InChI | InChI=1S/C29H46O4S3/c1-21-14-16-29(32-26(21)13-12-24(4)28(5)34-18-9-19-35-28)17-15-22(2)27(33-29)23(3)20-36(30,31)25-10-7-6-8-11-25/h6-8,10-11,21-24,26-27H,9,12-20H2,1-5H3/t21-,22+,23-,24+,26+,27-,29-/m1/s1 |
| InChIKey | BIHKSZQRBJDREZ-YMXIIGBXSA-N |
| XLogP | 7.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.88 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |