C19H26O4S — CID 11450958
(2S,3S,3aR,7aR)-3-(4-methylphenyl)sulfonylspiro[3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2,2'-oxane] (PubChem CID 11450958) has the molecular formula C19H26O4S and a molecular weight of 350.48 g/mol. Its IUPAC name is (2S,3S,3aR,7aR)-3-(4-methylphenyl)sulfonylspiro[3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2,2'-oxane].
| Compound Name | (2S,3S,3aR,7aR)-3-(4-methylphenyl)sulfonylspiro[3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2,2'-oxane] |
|---|---|
| PubChem CID | 11450958 |
| Molecular Formula | C19H26O4S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (2S,3S,3aR,7aR)-3-(4-methylphenyl)sulfonylspiro[3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2,2'-oxane] |
| SMILES | Cc1ccc(S(=O)(=O)[C@H]2[C@@H]3CCCC[C@H]3O[C@@]23CCCCO3)cc1 |
| InChI | InChI=1S/C19H26O4S/c1-14-8-10-15(11-9-14)24(20,21)18-16-6-2-3-7-17(16)23-19(18)12-4-5-13-22-19/h8-11,16-18H,2-7,12-13H2,1H3/t16-,17-,18+,19+/m1/s1 |
| InChIKey | GHRWEIWPVRUIOS-YRXWBPOGSA-N |
| XLogP | 3.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |