C26H40O4S — CID 10939278
(2R,3S,6R,8S,9R)-2-[(2S)-1-(benzenesulfonyl)propan-2-yl]-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecane (PubChem CID 10939278) has the molecular formula C26H40O4S and a molecular weight of 448.67 g/mol. Its IUPAC name is (2R,3S,6R,8S,9R)-2-[(2S)-1-(benzenesulfonyl)propan-2-yl]-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecane.
| Compound Name | (2R,3S,6R,8S,9R)-2-[(2S)-1-(benzenesulfonyl)propan-2-yl]-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 10939278 |
| Molecular Formula | C26H40O4S |
| Molecular Weight | 448.67 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | (2R,3S,6R,8S,9R)-2-[(2S)-1-(benzenesulfonyl)propan-2-yl]-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecane |
| SMILES | C=C[C@@H](C)CC[C@@H]1O[C@@]2(CC[C@H]1C)CC[C@H](C)[C@H]([C@H](C)CS(=O)(=O)c1ccccc1)O2 |
| InChI | InChI=1S/C26H40O4S/c1-6-19(2)12-13-24-20(3)14-16-26(29-24)17-15-21(4)25(30-26)22(5)18-31(27,28)23-10-8-7-9-11-23/h6-11,19-22,24-25H,1,12-18H2,2-5H3/t19-,20-,21+,22-,24+,25-,26-/m1/s1 |
| InChIKey | VJAYWCDRLLUXBY-DNQZVJBRSA-N |
| XLogP | 6.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.67 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|