C18H24O2S — CID 10902799
(2S,6S)-4-methylidene-2-(2-phenylsulfanylethyl)-1,7-dioxaspiro[5.5]undecane (PubChem CID 10902799) has the molecular formula C18H24O2S and a molecular weight of 304.45 g/mol. Its IUPAC name is (2S,6S)-4-methylidene-2-(2-phenylsulfanylethyl)-1,7-dioxaspiro[5.5]undecane.
| Compound Name | (2S,6S)-4-methylidene-2-(2-phenylsulfanylethyl)-1,7-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 10902799 |
| Molecular Formula | C18H24O2S |
| Molecular Weight | 304.45 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (2S,6S)-4-methylidene-2-(2-phenylsulfanylethyl)-1,7-dioxaspiro[5.5]undecane |
| SMILES | C=C1C[C@@H](CCSc2ccccc2)O[C@@]2(CCCCO2)C1 |
| InChI | InChI=1S/C18H24O2S/c1-15-13-16(9-12-21-17-7-3-2-4-8-17)20-18(14-15)10-5-6-11-19-18/h2-4,7-8,16H,1,5-6,9-14H2/t16-,18+/m1/s1 |
| InChIKey | BRNHHVNJGPKJBD-AEFFLSMTSA-N |
| XLogP | 4.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|