C16H20O3S — CID 14167471
(4S,6R)-4-[(1S)-1-[(2R)-oxiran-2-yl]prop-2-enyl]-6-(phenylsulfanylmethyl)-1,3-dioxane (PubChem CID 14167471) has the molecular formula C16H20O3S and a molecular weight of 292.40 g/mol. Its IUPAC name is (4S,6R)-4-[(1S)-1-[(2R)-oxiran-2-yl]prop-2-enyl]-6-(phenylsulfanylmethyl)-1,3-dioxane.
| Compound Name | (4S,6R)-4-[(1S)-1-[(2R)-oxiran-2-yl]prop-2-enyl]-6-(phenylsulfanylmethyl)-1,3-dioxane |
|---|---|
| PubChem CID | 14167471 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (4S,6R)-4-[(1S)-1-[(2R)-oxiran-2-yl]prop-2-enyl]-6-(phenylsulfanylmethyl)-1,3-dioxane |
| SMILES | C=C[C@H]([C@@H]1CO1)[C@@H]1C[C@H](CSc2ccccc2)OCO1 |
| InChI | InChI=1S/C16H20O3S/c1-2-14(16-9-17-16)15-8-12(18-11-19-15)10-20-13-6-4-3-5-7-13/h2-7,12,14-16H,1,8-11H2/t12-,14+,15+,16+/m1/s1 |
| InChIKey | VJOPVNIQXHPBSL-OEAJRASXSA-N |
| XLogP | 3.11 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|