C22H34O4S — CID 135048532
(2R,4R,5S,6R)-4-[(2S,4R,5R)-5-ethyl-2,4-dimethyl-1,3-dioxolan-4-yl]-2,5-dimethyl-6-[(2S)-1-phenylsulfanylpropan-2-yl]-1,3-dioxane (PubChem CID 135048532) has the molecular formula C22H34O4S and a molecular weight of 394.58 g/mol. Its IUPAC name is (2R,4R,5S,6R)-4-[(2S,4R,5R)-5-ethyl-2,4-dimethyl-1,3-dioxolan-4-yl]-2,5-dimethyl-6-[(2S)-1-phenylsulfanylpropan-2-yl]-1,3-dioxane.
| Compound Name | (2R,4R,5S,6R)-4-[(2S,4R,5R)-5-ethyl-2,4-dimethyl-1,3-dioxolan-4-yl]-2,5-dimethyl-6-[(2S)-1-phenylsulfanylpropan-2-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 135048532 |
| Molecular Formula | C22H34O4S |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | (2R,4R,5S,6R)-4-[(2S,4R,5R)-5-ethyl-2,4-dimethyl-1,3-dioxolan-4-yl]-2,5-dimethyl-6-[(2S)-1-phenylsulfanylpropan-2-yl]-1,3-dioxane |
| SMILES | CC[C@H]1O[C@H](C)O[C@@]1(C)[C@@H]1O[C@H](C)O[C@@H]([C@H](C)CSc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C22H34O4S/c1-7-19-22(6,26-17(5)23-19)21-15(3)20(24-16(4)25-21)14(2)13-27-18-11-9-8-10-12-18/h8-12,14-17,19-21H,7,13H2,1-6H3/t14-,15+,16-,17+,19-,20+,21-,22-/m1/s1 |
| InChIKey | XMHVWEHVCIRACT-NOBZEYELSA-N |
| XLogP | 5.11 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |