C21H34O2S — CID 134878898
(2S,4S,6R)-4-hexyl-4,6-dimethyl-6-phenylsulfanyl-2-propan-2-yl-1,3-dioxane (PubChem CID 134878898) has the molecular formula C21H34O2S and a molecular weight of 350.57 g/mol. Its IUPAC name is (2S,4S,6R)-4-hexyl-4,6-dimethyl-6-phenylsulfanyl-2-propan-2-yl-1,3-dioxane.
| Compound Name | (2S,4S,6R)-4-hexyl-4,6-dimethyl-6-phenylsulfanyl-2-propan-2-yl-1,3-dioxane |
|---|---|
| PubChem CID | 134878898 |
| Molecular Formula | C21H34O2S |
| Molecular Weight | 350.57 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (2S,4S,6R)-4-hexyl-4,6-dimethyl-6-phenylsulfanyl-2-propan-2-yl-1,3-dioxane |
| SMILES | CCCCCC[C@@]1(C)C[C@@](C)(Sc2ccccc2)O[C@@H](C(C)C)O1 |
| InChI | InChI=1S/C21H34O2S/c1-6-7-8-12-15-20(4)16-21(5,23-19(22-20)17(2)3)24-18-13-10-9-11-14-18/h9-11,13-14,17,19H,6-8,12,15-16H2,1-5H3/t19-,20-,21+/m0/s1 |
| InChIKey | MYGDBFRDZYXGLC-PCCBWWKXSA-N |
| XLogP | 6.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.57 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|