C16H22O2S — CID 135050719
(6S)-6-[(2S)-oxiran-2-yl]-2-phenylsulfanyl-2-propan-2-yloxane (PubChem CID 135050719) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is (6S)-6-[(2S)-oxiran-2-yl]-2-phenylsulfanyl-2-propan-2-yloxane.
| Compound Name | (6S)-6-[(2S)-oxiran-2-yl]-2-phenylsulfanyl-2-propan-2-yloxane |
|---|---|
| PubChem CID | 135050719 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (6S)-6-[(2S)-oxiran-2-yl]-2-phenylsulfanyl-2-propan-2-yloxane |
| SMILES | CC(C)C1(Sc2ccccc2)CCC[C@@H]([C@@H]2CO2)O1 |
| InChI | InChI=1S/C16H22O2S/c1-12(2)16(19-13-7-4-3-5-8-13)10-6-9-14(18-16)15-11-17-15/h3-5,7-8,12,14-15H,6,9-11H2,1-2H3/t14-,15-,16?/m0/s1 |
| InChIKey | CPCMMHRJTUYVQD-KSCSMHSMSA-N |
| XLogP | 4.10 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|