C26H44O2S — CID 14025357
(2R,3R)-2-decyl-3-(5-methylhexyl)-2-(4-methylphenyl)sulfinyloxirane (PubChem CID 14025357) has the molecular formula C26H44O2S and a molecular weight of 420.70 g/mol. Its IUPAC name is (2R,3R)-2-decyl-3-(5-methylhexyl)-2-(4-methylphenyl)sulfinyloxirane.
| Compound Name | (2R,3R)-2-decyl-3-(5-methylhexyl)-2-(4-methylphenyl)sulfinyloxirane |
|---|---|
| PubChem CID | 14025357 |
| Molecular Formula | C26H44O2S |
| Molecular Weight | 420.70 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | (2R,3R)-2-decyl-3-(5-methylhexyl)-2-(4-methylphenyl)sulfinyloxirane |
| SMILES | CCCCCCCCCC[C@]1(S(=O)c2ccc(C)cc2)O[C@@H]1CCCCC(C)C |
| InChI | InChI=1S/C26H44O2S/c1-5-6-7-8-9-10-11-14-21-26(25(28-26)16-13-12-15-22(2)3)29(27)24-19-17-23(4)18-20-24/h17-20,22,25H,5-16,21H2,1-4H3/t25-,26-,29?/m1/s1 |
| InChIKey | YNLRLJVNGRXRIK-CRMLLVLTSA-N |
| XLogP | 7.94 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.70 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|