C15H19FO2S — CID 101025299
(2S)-2-[(1R)-1-fluoropent-4-enyl]-2-[(4-methylphenyl)sulfinylmethyl]oxirane (PubChem CID 101025299) has the molecular formula C15H19FO2S and a molecular weight of 282.38 g/mol. Its IUPAC name is (2S)-2-[(1R)-1-fluoropent-4-enyl]-2-[(4-methylphenyl)sulfinylmethyl]oxirane.
| Compound Name | (2S)-2-[(1R)-1-fluoropent-4-enyl]-2-[(4-methylphenyl)sulfinylmethyl]oxirane |
|---|---|
| PubChem CID | 101025299 |
| Molecular Formula | C15H19FO2S |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | (2S)-2-[(1R)-1-fluoropent-4-enyl]-2-[(4-methylphenyl)sulfinylmethyl]oxirane |
| SMILES | C=CCC[C@@H](F)[C@]1(CS(=O)c2ccc(C)cc2)CO1 |
| InChI | InChI=1S/C15H19FO2S/c1-3-4-5-14(16)15(10-18-15)11-19(17)13-8-6-12(2)7-9-13/h3,6-9,14H,1,4-5,10-11H2,2H3/t14-,15-,19?/m1/s1 |
| InChIKey | BYRQHKSUJCAGLO-YCQNMSHMSA-N |
| XLogP | 3.18 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|