C13H16ClFHgO2S — CID 134880965
chloro-[[(2R,4R,5S)-4-fluoro-5-[(4-methylphenyl)sulfinylmethyl]oxolan-2-yl]methyl]mercury (PubChem CID 134880965) has the molecular formula C13H16ClFHgO2S and a molecular weight of 491.38 g/mol. Its IUPAC name is chloro-[[(2R,4R,5S)-4-fluoro-5-[(4-methylphenyl)sulfinylmethyl]oxolan-2-yl]methyl]mercury.
| Compound Name | chloro-[[(2R,4R,5S)-4-fluoro-5-[(4-methylphenyl)sulfinylmethyl]oxolan-2-yl]methyl]mercury |
|---|---|
| PubChem CID | 134880965 |
| Molecular Formula | C13H16ClFHgO2S |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | chloro-[[(2R,4R,5S)-4-fluoro-5-[(4-methylphenyl)sulfinylmethyl]oxolan-2-yl]methyl]mercury |
| SMILES | Cc1ccc(S(=O)C[C@H]2O[C@@H](C[Hg]Cl)C[C@H]2F)cc1 |
| InChI | InChI=1S/C13H16FO2S.ClH.Hg/c1-9-3-5-11(6-4-9)17(15)8-13-12(14)7-10(2)16-13;;/h3-6,10,12-13H,2,7-8H2,1H3;1H;/q;;+1/p-1/t10-,12+,13+,17?;;/m0../s1 |
| InChIKey | DYQKPGIRBSOORA-IPCDCHESSA-M |
| XLogP | 3.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|