C17H17FO2S — CID 102439588
(2S)-2-(fluoromethyl)-2-[(S)-(4-methylphenyl)sulfinyl-phenylmethyl]oxirane (PubChem CID 102439588) has the molecular formula C17H17FO2S and a molecular weight of 304.39 g/mol. Its IUPAC name is (2S)-2-(fluoromethyl)-2-[(S)-(4-methylphenyl)sulfinyl-phenylmethyl]oxirane.
| Compound Name | (2S)-2-(fluoromethyl)-2-[(S)-(4-methylphenyl)sulfinyl-phenylmethyl]oxirane |
|---|---|
| PubChem CID | 102439588 |
| Molecular Formula | C17H17FO2S |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (2S)-2-(fluoromethyl)-2-[(S)-(4-methylphenyl)sulfinyl-phenylmethyl]oxirane |
| SMILES | Cc1ccc(S(=O)[C@@H](c2ccccc2)[C@@]2(CF)CO2)cc1 |
| InChI | InChI=1S/C17H17FO2S/c1-13-7-9-15(10-8-13)21(19)16(17(11-18)12-20-17)14-5-3-2-4-6-14/h2-10,16H,11-12H2,1H3/t16-,17+,21?/m0/s1 |
| InChIKey | IUTBXOAMSINLBT-NXRUOVBSSA-N |
| XLogP | 3.58 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|