C19H23FO2S — CID 135060806
(1S,2R)-1-fluoro-1-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]hexan-2-ol (PubChem CID 135060806) has the molecular formula C19H23FO2S and a molecular weight of 334.46 g/mol. Its IUPAC name is (1S,2R)-1-fluoro-1-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]hexan-2-ol.
| Compound Name | (1S,2R)-1-fluoro-1-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]hexan-2-ol |
|---|---|
| PubChem CID | 135060806 |
| Molecular Formula | C19H23FO2S |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (1S,2R)-1-fluoro-1-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]hexan-2-ol |
| SMILES | CCCC[C@@H](O)[C@@H](F)c1ccccc1[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H23FO2S/c1-3-4-8-17(21)19(20)16-7-5-6-9-18(16)23(22)15-12-10-14(2)11-13-15/h5-7,9-13,17,19,21H,3-4,8H2,1-2H3/t17-,19+,23+/m1/s1 |
| InChIKey | LFKPDYZWGXJCKC-FHJLPGHOSA-N |
| XLogP | 4.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |