C13H13F5O2S — CID 134929025
(2R)-2-[[(R)-(4-methylphenyl)sulfinyl]methyl]-2-(2,2,3,3,3-pentafluoropropyl)oxirane (PubChem CID 134929025) has the molecular formula C13H13F5O2S and a molecular weight of 328.30 g/mol. Its IUPAC name is (2R)-2-[[(R)-(4-methylphenyl)sulfinyl]methyl]-2-(2,2,3,3,3-pentafluoropropyl)oxirane.
| Compound Name | (2R)-2-[[(R)-(4-methylphenyl)sulfinyl]methyl]-2-(2,2,3,3,3-pentafluoropropyl)oxirane |
|---|---|
| PubChem CID | 134929025 |
| Molecular Formula | C13H13F5O2S |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | (2R)-2-[[(R)-(4-methylphenyl)sulfinyl]methyl]-2-(2,2,3,3,3-pentafluoropropyl)oxirane |
| SMILES | Cc1ccc([S@](=O)C[C@@]2(CC(F)(F)C(F)(F)F)CO2)cc1 |
| InChI | InChI=1S/C13H13F5O2S/c1-9-2-4-10(5-3-9)21(19)8-11(7-20-11)6-12(14,15)13(16,17)18/h2-5H,6-8H2,1H3/t11-,21-/m1/s1 |
| InChIKey | MWPUBHRXISHXTL-WSVYEEACSA-N |
| XLogP | 3.46 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|