C18H25F3O3S — CID 123340007
2-butan-2-yl-4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane (PubChem CID 123340007) has the molecular formula C18H25F3O3S and a molecular weight of 378.46 g/mol. Its IUPAC name is 2-butan-2-yl-4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane.
| Compound Name | 2-butan-2-yl-4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane |
|---|---|
| PubChem CID | 123340007 |
| Molecular Formula | C18H25F3O3S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 2-butan-2-yl-4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane |
| SMILES | CCC(C)C1CC(CC)(S(=O)(=O)c2cccc(C(F)(F)F)c2)CCO1 |
| InChI | InChI=1S/C18H25F3O3S/c1-4-13(3)16-12-17(5-2,9-10-24-16)25(22,23)15-8-6-7-14(11-15)18(19,20)21/h6-8,11,13,16H,4-5,9-10,12H2,1-3H3 |
| InChIKey | HBPOCUGVINZNON-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |