C14H18F2O3S — CID 19804783
2-(benzenesulfonyl)-1-cyclohexyl-2,2-difluoroethanol (PubChem CID 19804783) has the molecular formula C14H18F2O3S and a molecular weight of 304.36 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-cyclohexyl-2,2-difluoroethanol.
| Compound Name | 2-(benzenesulfonyl)-1-cyclohexyl-2,2-difluoroethanol |
|---|---|
| PubChem CID | 19804783 |
| Molecular Formula | C14H18F2O3S |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-(benzenesulfonyl)-1-cyclohexyl-2,2-difluoroethanol |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)C(O)C1CCCCC1 |
| InChI | InChI=1S/C14H18F2O3S/c15-14(16,13(17)11-7-3-1-4-8-11)20(18,19)12-9-5-2-6-10-12/h2,5-6,9-11,13,17H,1,3-4,7-8H2 |
| InChIKey | YVLCFEKYJYKHEN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |