C14H20F4OS2 — CID 158003178
(1S)-1-cyclopentyl-2,2,3,3-tetrafluoro-3-phenylpropan-1-ol;sulfane (PubChem CID 158003178) has the molecular formula C14H20F4OS2 and a molecular weight of 344.44 g/mol. Its IUPAC name is (1S)-1-cyclopentyl-2,2,3,3-tetrafluoro-3-phenylpropan-1-ol;sulfane.
| Compound Name | (1S)-1-cyclopentyl-2,2,3,3-tetrafluoro-3-phenylpropan-1-ol;sulfane |
|---|---|
| PubChem CID | 158003178 |
| Molecular Formula | C14H20F4OS2 |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | (1S)-1-cyclopentyl-2,2,3,3-tetrafluoro-3-phenylpropan-1-ol;sulfane |
| SMILES | O[C@@H](C1CCCC1)C(F)(F)C(F)(F)c1ccccc1.S.S |
| InChI | InChI=1S/C14H16F4O.2H2S/c15-13(16,11-8-2-1-3-9-11)14(17,18)12(19)10-6-4-5-7-10;;/h1-3,8-10,12,19H,4-7H2;2*1H2/t12-;;/m0../s1 |
| InChIKey | FDZAEYIIWDRDDI-LTCKWSDVSA-N |
| XLogP | 4.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|