C10H13F7O — CID 154329934
1-cyclohexyl-2,2,3,3,4,4,4-heptafluorobutan-1-ol (PubChem CID 154329934) has the molecular formula C10H13F7O and a molecular weight of 282.20 g/mol. Its IUPAC name is 1-cyclohexyl-2,2,3,3,4,4,4-heptafluorobutan-1-ol.
| Compound Name | 1-cyclohexyl-2,2,3,3,4,4,4-heptafluorobutan-1-ol |
|---|---|
| PubChem CID | 154329934 |
| Molecular Formula | C10H13F7O |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 1-cyclohexyl-2,2,3,3,4,4,4-heptafluorobutan-1-ol |
| SMILES | OC(C1CCCCC1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F7O/c11-8(12,9(13,14)10(15,16)17)7(18)6-4-2-1-3-5-6/h6-7,18H,1-5H2 |
| InChIKey | JKZMKNSFNJZEFV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|