C14H31IOSi2 — CID 10501047
1-cyclohexyl-2-iodo-2,2-bis(trimethylsilyl)ethanol (PubChem CID 10501047) has the molecular formula C14H31IOSi2 and a molecular weight of 398.48 g/mol. Its IUPAC name is 1-cyclohexyl-2-iodo-2,2-bis(trimethylsilyl)ethanol.
| Compound Name | 1-cyclohexyl-2-iodo-2,2-bis(trimethylsilyl)ethanol |
|---|---|
| PubChem CID | 10501047 |
| Molecular Formula | C14H31IOSi2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 1-cyclohexyl-2-iodo-2,2-bis(trimethylsilyl)ethanol |
| SMILES | C[Si](C)(C)C(I)(C(O)C1CCCCC1)[Si](C)(C)C |
| InChI | InChI=1S/C14H31IOSi2/c1-17(2,3)14(15,18(4,5)6)13(16)12-10-8-7-9-11-12/h12-13,16H,7-11H2,1-6H3 |
| InChIKey | UCYOSGNPTYSESL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|