C9H13F2O3- — CID 164746791
3-cyclohexyl-2,2-difluoro-3-hydroxypropanoate (PubChem CID 164746791) has the molecular formula C9H13F2O3- and a molecular weight of 207.20 g/mol. Its IUPAC name is 3-cyclohexyl-2,2-difluoro-3-hydroxypropanoate.
| Compound Name | 3-cyclohexyl-2,2-difluoro-3-hydroxypropanoate |
|---|---|
| PubChem CID | 164746791 |
| Molecular Formula | C9H13F2O3- |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 3-cyclohexyl-2,2-difluoro-3-hydroxypropanoate |
| SMILES | O=C([O-])C(F)(F)C(O)C1CCCCC1 |
| InChI | InChI=1S/C9H14F2O3/c10-9(11,8(13)14)7(12)6-4-2-1-3-5-6/h6-7,12H,1-5H2,(H,13,14)/p-1 |
| InChIKey | VHMUUCCRPDFGKL-UHFFFAOYSA-M |
| XLogP | 0.31 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |