C10H15F2O5S- — CID 164747691
3-cyclohexyl-2,2-difluoro-3-methylsulfonyloxypropanoate (PubChem CID 164747691) has the molecular formula C10H15F2O5S- and a molecular weight of 285.29 g/mol. Its IUPAC name is 3-cyclohexyl-2,2-difluoro-3-methylsulfonyloxypropanoate.
| Compound Name | 3-cyclohexyl-2,2-difluoro-3-methylsulfonyloxypropanoate |
|---|---|
| PubChem CID | 164747691 |
| Molecular Formula | C10H15F2O5S- |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 3-cyclohexyl-2,2-difluoro-3-methylsulfonyloxypropanoate |
| SMILES | CS(=O)(=O)OC(C1CCCCC1)C(F)(F)C(=O)[O-] |
| InChI | InChI=1S/C10H16F2O5S/c1-18(15,16)17-8(10(11,12)9(13)14)7-5-3-2-4-6-7/h7-8H,2-6H2,1H3,(H,13,14)/p-1 |
| InChIKey | ZHPBRFQXINAQJB-UHFFFAOYSA-M |
| XLogP | 0.30 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|