C16H31NO5S — CID 87303013
tert-butyl-[(2S,3R)-1-cyclohexyl-3-methylsulfonyloxybutan-2-yl]carbamic acid (PubChem CID 87303013) has the molecular formula C16H31NO5S and a molecular weight of 349.49 g/mol. Its IUPAC name is tert-butyl-[(2S,3R)-1-cyclohexyl-3-methylsulfonyloxybutan-2-yl]carbamic acid.
| Compound Name | tert-butyl-[(2S,3R)-1-cyclohexyl-3-methylsulfonyloxybutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87303013 |
| Molecular Formula | C16H31NO5S |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | tert-butyl-[(2S,3R)-1-cyclohexyl-3-methylsulfonyloxybutan-2-yl]carbamic acid |
| SMILES | C[C@@H](OS(C)(=O)=O)[C@H](CC1CCCCC1)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C16H31NO5S/c1-12(22-23(5,20)21)14(11-13-9-7-6-8-10-13)17(15(18)19)16(2,3)4/h12-14H,6-11H2,1-5H3,(H,18,19)/t12-,14+/m1/s1 |
| InChIKey | WWVPALFDCDSURU-OCCSQVGLSA-N |
| XLogP | 3.47 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|