About 3-cyclohexyl-2,2-difluoro-3-[2-(1-methylcyclohexyl)oxycarbonylbenzoyl]oxypropanoate
3-cyclohexyl-2,2-difluoro-3-[2-(1-methylcyclohexyl)oxycarbonylbenzoyl]oxypropanoate (PubChem CID 156684943) has the molecular formula C24H29F2O6-
and a molecular weight of 451.49 g/mol. Its IUPAC name is 3-cyclohexyl-2,2-difluoro-3-[2-(1-methylcyclohexyl)oxycarbonylbenzoyl]oxypropanoate.
Molecular Properties
| Compound Name | 3-cyclohexyl-2,2-difluoro-3-[2-(1-methylcyclohexyl)oxycarbonylbenzoyl]oxypropanoate |
| PubChem CID | 156684943 |
| Molecular Formula | C24H29F2O6- |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 3-cyclohexyl-2,2-difluoro-3-[2-(1-methylcyclohexyl)oxycarbonylbenzoyl]oxypropanoate |
| SMILES | CC1(OC(=O)c2ccccc2C(=O)OC(C2CCCCC2)C(F)(F)C(=O)[O-])CCCCC1 |
| InChI | InChI=1S/C24H30F2O6/c1-23(14-8-3-9-15-23)32-21(28)18-13-7-6-12-17(18)20(27)31-19(24(25,26)22(29)30)16-10-4-2-5-11-16/h6-7,12-13,16,19H,2-5,8-11,14-15H2,1H3,(H,29,30)/p-1 |
| InChIKey | YKJNEIKEZLMOPT-UHFFFAOYSA-M |
| XLogP | 4.06 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-cyclohexyl-2,2-difluoro-3-[2-(1-methylcyclohexyl)oxycarbonylbenzoyl]oxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-2,2-difluoro-3-[2-(1-methylcyclohexyl)oxycarbonylbenzoyl]oxypropanoate?
The IUPAC name of 3-cyclohexyl-2,2-difluoro-3-[2-(1-methylcyclohexyl)oxycarbonylbenzoyl]oxypropanoate (CID 156684943) is 3-cyclohexyl-2,2-difluoro-3-[2-(1-methylcyclohexyl)oxycarbonylbenzoyl]oxypropanoate.
What is the SMILES notation for 3-cyclohexyl-2,2-difluoro-3-[2-(1-methylcyclohexyl)oxycarbonylbenzoyl]oxypropanoate?
The canonical SMILES for 3-cyclohexyl-2,2-difluoro-3-[2-(1-methylcyclohexyl)oxycarbonylbenzoyl]oxypropanoate is CC1(OC(=O)c2ccccc2C(=O)OC(C2CCCCC2)C(F)(F)C(=O)[O-])CCCCC1.
What is the InChIKey of 3-cyclohexyl-2,2-difluoro-3-[2-(1-methylcyclohexyl)oxycarbonylbenzoyl]oxypropanoate?
The InChIKey is YKJNEIKEZLMOPT-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H30F2O6/c1-23(14-8-3-9-15-23)32-21(28)18-13-7-6-12-17(18)20(27)31-19(24(25,26)22(29)30)16-10-4-2-5-11-16/h6-7,12-13,16,19H,2-5,8-11,14-15H2,1H3,(H,29,30)/p-1.
What are the key properties of 3-cyclohexyl-2,2-difluoro-3-[2-(1-methylcyclohexyl)oxycarbonylbenzoyl]oxypropanoate?
3-cyclohexyl-2,2-difluoro-3-[2-(1-methylcyclohexyl)oxycarbonylbenzoyl]oxypropanoate has a molecular weight of 451.49 g/mol, XLogP of 4.06, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-2,2-difluoro-3-[2-(1-methylcyclohexyl)oxycarbonylbenzoyl]oxypropanoate is sourced from PubChem (CID 156684943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).