C15H14F2IO4- — CID 171407127
3-cyclopentyl-2,2-difluoro-3-(4-iodobenzoyl)oxypropanoate (PubChem CID 171407127) has the molecular formula C15H14F2IO4- and a molecular weight of 423.17 g/mol. Its IUPAC name is 3-cyclopentyl-2,2-difluoro-3-(4-iodobenzoyl)oxypropanoate.
| Compound Name | 3-cyclopentyl-2,2-difluoro-3-(4-iodobenzoyl)oxypropanoate |
|---|---|
| PubChem CID | 171407127 |
| Molecular Formula | C15H14F2IO4- |
| Molecular Weight | 423.17 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | 3-cyclopentyl-2,2-difluoro-3-(4-iodobenzoyl)oxypropanoate |
| SMILES | O=C(OC(C1CCCC1)C(F)(F)C(=O)[O-])c1ccc(I)cc1 |
| InChI | InChI=1S/C15H15F2IO4/c16-15(17,14(20)21)12(9-3-1-2-4-9)22-13(19)10-5-7-11(18)8-6-10/h5-9,12H,1-4H2,(H,20,21)/p-1 |
| InChIKey | PFPCTFXLIITEIC-UHFFFAOYSA-M |
| XLogP | 2.39 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.17 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|