C18H22FIO5 — CID 156523047
3-cyclohexyl-2-fluoro-3-(2-hydroxy-3-iodo-5-methylbenzoyl)oxy-2-methylpropanoic acid (PubChem CID 156523047) has the molecular formula C18H22FIO5 and a molecular weight of 464.27 g/mol. Its IUPAC name is 3-cyclohexyl-2-fluoro-3-(2-hydroxy-3-iodo-5-methylbenzoyl)oxy-2-methylpropanoic acid.
| Compound Name | 3-cyclohexyl-2-fluoro-3-(2-hydroxy-3-iodo-5-methylbenzoyl)oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 156523047 |
| Molecular Formula | C18H22FIO5 |
| Molecular Weight | 464.27 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 3-cyclohexyl-2-fluoro-3-(2-hydroxy-3-iodo-5-methylbenzoyl)oxy-2-methylpropanoic acid |
| SMILES | Cc1cc(I)c(O)c(C(=O)OC(C2CCCCC2)C(C)(F)C(=O)O)c1 |
| InChI | InChI=1S/C18H22FIO5/c1-10-8-12(14(21)13(20)9-10)16(22)25-15(18(2,19)17(23)24)11-6-4-3-5-7-11/h8-9,11,15,21H,3-7H2,1-2H3,(H,23,24) |
| InChIKey | CNSHKTHGRNEJBO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|