C8H11F2O3- — CID 164746573
2-cyclohexyloxy-2,2-difluoroacetate (PubChem CID 164746573) has the molecular formula C8H11F2O3- and a molecular weight of 193.17 g/mol. Its IUPAC name is 2-cyclohexyloxy-2,2-difluoroacetate.
| Compound Name | 2-cyclohexyloxy-2,2-difluoroacetate |
|---|---|
| PubChem CID | 164746573 |
| Molecular Formula | C8H11F2O3- |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-cyclohexyloxy-2,2-difluoroacetate |
| SMILES | O=C([O-])C(F)(F)OC1CCCCC1 |
| InChI | InChI=1S/C8H12F2O3/c9-8(10,7(11)12)13-6-4-2-1-3-5-6/h6H,1-5H2,(H,11,12)/p-1 |
| InChIKey | ITKWGTAYNISHKN-UHFFFAOYSA-M |
| XLogP | 0.68 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |