C11H13F6O3- — CID 164746907
3-cyclohexyloxy-4,4,4-trifluoro-3-(trifluoromethyl)butanoate (PubChem CID 164746907) has the molecular formula C11H13F6O3- and a molecular weight of 307.21 g/mol. Its IUPAC name is 3-cyclohexyloxy-4,4,4-trifluoro-3-(trifluoromethyl)butanoate.
| Compound Name | 3-cyclohexyloxy-4,4,4-trifluoro-3-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 164746907 |
| Molecular Formula | C11H13F6O3- |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 3-cyclohexyloxy-4,4,4-trifluoro-3-(trifluoromethyl)butanoate |
| SMILES | O=C([O-])CC(OC1CCCCC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H14F6O3/c12-10(13,14)9(6-8(18)19,11(15,16)17)20-7-4-2-1-3-5-7/h7H,1-6H2,(H,18,19)/p-1 |
| InChIKey | ZHTKHEXNPZWOKM-UHFFFAOYSA-M |
| XLogP | 2.34 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |