C13H22F3NO2 — CID 67340942
1-cyclohexylpiperidin-1-ium;2,2,2-trifluoroacetate (PubChem CID 67340942) has the molecular formula C13H22F3NO2 and a molecular weight of 281.32 g/mol. Its IUPAC name is 1-cyclohexylpiperidin-1-ium;2,2,2-trifluoroacetate.
| Compound Name | 1-cyclohexylpiperidin-1-ium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67340942 |
| Molecular Formula | C13H22F3NO2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 1-cyclohexylpiperidin-1-ium;2,2,2-trifluoroacetate |
| SMILES | C1CCC([NH+]2CCCCC2)CC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C11H21N.C2HF3O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;3-2(4,5)1(6)7/h11H,1-10H2;(H,6,7) |
| InChIKey | RWWQYKHUHSXODY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |