C12H15F4O4- — CID 164747567
4-(2-cyclohexylethoxy)-2,2,3,3-tetrafluoro-4-oxobutanoate (PubChem CID 164747567) has the molecular formula C12H15F4O4- and a molecular weight of 299.24 g/mol. Its IUPAC name is 4-(2-cyclohexylethoxy)-2,2,3,3-tetrafluoro-4-oxobutanoate.
| Compound Name | 4-(2-cyclohexylethoxy)-2,2,3,3-tetrafluoro-4-oxobutanoate |
|---|---|
| PubChem CID | 164747567 |
| Molecular Formula | C12H15F4O4- |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 4-(2-cyclohexylethoxy)-2,2,3,3-tetrafluoro-4-oxobutanoate |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(=O)OCCC1CCCCC1 |
| InChI | InChI=1S/C12H16F4O4/c13-11(14,9(17)18)12(15,16)10(19)20-7-6-8-4-2-1-3-5-8/h8H,1-7H2,(H,17,18)/p-1 |
| InChIKey | KZIIGHCFPAPEMV-UHFFFAOYSA-M |
| XLogP | 1.52 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|