C11H18F3NO2 — CID 70951802
2-cyclohexylethyl N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 70951802) has the molecular formula C11H18F3NO2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-cyclohexylethyl N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | 2-cyclohexylethyl N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 70951802 |
| Molecular Formula | C11H18F3NO2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-cyclohexylethyl N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | O=C(NCC(F)(F)F)OCCC1CCCCC1 |
| InChI | InChI=1S/C11H18F3NO2/c12-11(13,14)8-15-10(16)17-7-6-9-4-2-1-3-5-9/h9H,1-8H2,(H,15,16) |
| InChIKey | CNAZZRVDYZYONI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |