C11H19F3N2O2 — CID 113225931
1-(2-cyclohexyloxyethyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 113225931) has the molecular formula C11H19F3N2O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 1-(2-cyclohexyloxyethyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(2-cyclohexyloxyethyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 113225931 |
| Molecular Formula | C11H19F3N2O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-(2-cyclohexyloxyethyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCCOC1CCCCC1)NCC(F)(F)F |
| InChI | InChI=1S/C11H19F3N2O2/c12-11(13,14)8-16-10(17)15-6-7-18-9-4-2-1-3-5-9/h9H,1-8H2,(H2,15,16,17) |
| InChIKey | RWFRVSSUFWMBDI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|