C13H23N3O5 — CID 63832822
2-[[2-(2-cyclohexyloxyethylcarbamoylamino)acetyl]amino]acetic acid (PubChem CID 63832822) has the molecular formula C13H23N3O5 and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-[[2-(2-cyclohexyloxyethylcarbamoylamino)acetyl]amino]acetic acid.
| Compound Name | 2-[[2-(2-cyclohexyloxyethylcarbamoylamino)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 63832822 |
| Molecular Formula | C13H23N3O5 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 2-[[2-(2-cyclohexyloxyethylcarbamoylamino)acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CNC(=O)NCCOC1CCCCC1 |
| InChI | InChI=1S/C13H23N3O5/c17-11(15-9-12(18)19)8-16-13(20)14-6-7-21-10-4-2-1-3-5-10/h10H,1-9H2,(H,15,17)(H,18,19)(H2,14,16,20) |
| InChIKey | IOWCSGWQVQUELG-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|