C16H32N2O3 — CID 111428431
1-(2-cycloheptyloxyethyl)-3-(2-hydroxy-3,3-dimethylbutyl)urea (PubChem CID 111428431) has the molecular formula C16H32N2O3 and a molecular weight of 300.44 g/mol. Its IUPAC name is 1-(2-cycloheptyloxyethyl)-3-(2-hydroxy-3,3-dimethylbutyl)urea.
| Compound Name | 1-(2-cycloheptyloxyethyl)-3-(2-hydroxy-3,3-dimethylbutyl)urea |
|---|---|
| PubChem CID | 111428431 |
| Molecular Formula | C16H32N2O3 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.24 |
| IUPAC Name | 1-(2-cycloheptyloxyethyl)-3-(2-hydroxy-3,3-dimethylbutyl)urea |
| SMILES | CC(C)(C)C(O)CNC(=O)NCCOC1CCCCCC1 |
| InChI | InChI=1S/C16H32N2O3/c1-16(2,3)14(19)12-18-15(20)17-10-11-21-13-8-6-4-5-7-9-13/h13-14,19H,4-12H2,1-3H3,(H2,17,18,20) |
| InChIKey | ZSERNPDQEOXRDG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|