C15H29N3O3 — CID 56814193
3-(3-cyclohexyloxypropylcarbamoylamino)-2,2-dimethylpropanamide (PubChem CID 56814193) has the molecular formula C15H29N3O3 and a molecular weight of 299.41 g/mol. Its IUPAC name is 3-(3-cyclohexyloxypropylcarbamoylamino)-2,2-dimethylpropanamide.
| Compound Name | 3-(3-cyclohexyloxypropylcarbamoylamino)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 56814193 |
| Molecular Formula | C15H29N3O3 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | 3-(3-cyclohexyloxypropylcarbamoylamino)-2,2-dimethylpropanamide |
| SMILES | CC(C)(CNC(=O)NCCCOC1CCCCC1)C(N)=O |
| InChI | InChI=1S/C15H29N3O3/c1-15(2,13(16)19)11-18-14(20)17-9-6-10-21-12-7-4-3-5-8-12/h12H,3-11H2,1-2H3,(H2,16,19)(H2,17,18,20) |
| InChIKey | UFSKYGUKWPJAHW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|