C15H29N3O3 — CID 95573643
2,2-dimethyl-3-[2-[(1R,2R)-2-methylcyclohexyl]oxyethylcarbamoylamino]propanamide (PubChem CID 95573643) has the molecular formula C15H29N3O3 and a molecular weight of 299.41 g/mol. Its IUPAC name is 2,2-dimethyl-3-[2-[(1R,2R)-2-methylcyclohexyl]oxyethylcarbamoylamino]propanamide.
| Compound Name | 2,2-dimethyl-3-[2-[(1R,2R)-2-methylcyclohexyl]oxyethylcarbamoylamino]propanamide |
|---|---|
| PubChem CID | 95573643 |
| Molecular Formula | C15H29N3O3 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | 2,2-dimethyl-3-[2-[(1R,2R)-2-methylcyclohexyl]oxyethylcarbamoylamino]propanamide |
| SMILES | C[C@@H]1CCCC[C@H]1OCCNC(=O)NCC(C)(C)C(N)=O |
| InChI | InChI=1S/C15H29N3O3/c1-11-6-4-5-7-12(11)21-9-8-17-14(20)18-10-15(2,3)13(16)19/h11-12H,4-10H2,1-3H3,(H2,16,19)(H2,17,18,20)/t11-,12-/m1/s1 |
| InChIKey | GVXFYMVUPHZJQO-VXGBXAGGSA-N |
| XLogP | 1.39 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|