C14H25F3N2O3 — CID 99846542
1-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-3-[(3R)-4,4,4-trifluoro-3-hydroxybutyl]urea (PubChem CID 99846542) has the molecular formula C14H25F3N2O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 1-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-3-[(3R)-4,4,4-trifluoro-3-hydroxybutyl]urea.
| Compound Name | 1-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-3-[(3R)-4,4,4-trifluoro-3-hydroxybutyl]urea |
|---|---|
| PubChem CID | 99846542 |
| Molecular Formula | C14H25F3N2O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 1-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-3-[(3R)-4,4,4-trifluoro-3-hydroxybutyl]urea |
| SMILES | C[C@@H]1CCCC[C@H]1OCCNC(=O)NCC[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C14H25F3N2O3/c1-10-4-2-3-5-11(10)22-9-8-19-13(21)18-7-6-12(20)14(15,16)17/h10-12,20H,2-9H2,1H3,(H2,18,19,21)/t10-,11-,12-/m1/s1 |
| InChIKey | CHSAIKGGTKNOQM-IJLUTSLNSA-N |
| XLogP | 2.19 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|