C16H22F3N3O2 — CID 97352901
1-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-3-[5-(trifluoromethyl)-2-pyridinyl]urea (PubChem CID 97352901) has the molecular formula C16H22F3N3O2 and a molecular weight of 345.37 g/mol. Its IUPAC name is 1-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-3-[5-(trifluoromethyl)-2-pyridinyl]urea.
| Compound Name | 1-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-3-[5-(trifluoromethyl)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 97352901 |
| Molecular Formula | C16H22F3N3O2 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-3-[5-(trifluoromethyl)-2-pyridinyl]urea |
| SMILES | C[C@@H]1CCCC[C@H]1OCCNC(=O)Nc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C16H22F3N3O2/c1-11-4-2-3-5-13(11)24-9-8-20-15(23)22-14-7-6-12(10-21-14)16(17,18)19/h6-7,10-11,13H,2-5,8-9H2,1H3,(H2,20,21,22,23)/t11-,13-/m1/s1 |
| InChIKey | XCZUZIBMNMQZSZ-DGCLKSJQSA-N |
| XLogP | 3.82 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|