C15H22F3N3O2 — CID 95157228
1-methyl-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 95157228) has the molecular formula C15H22F3N3O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is 1-methyl-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-methyl-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 95157228 |
| Molecular Formula | C15H22F3N3O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 1-methyl-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | C[C@@H]1CCCC[C@H]1OCCNC(=O)c1cnn(C)c1C(F)(F)F |
| InChI | InChI=1S/C15H22F3N3O2/c1-10-5-3-4-6-12(10)23-8-7-19-14(22)11-9-20-21(2)13(11)15(16,17)18/h9-10,12H,3-8H2,1-2H3,(H,19,22)/t10-,12-/m1/s1 |
| InChIKey | JFZXGWZZGOJUGO-ZYHUDNBSSA-N |
| XLogP | 2.76 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|