C19H26F3NO3 — CID 55717357
N-[2-(2-methylcyclohexyl)oxyethyl]-4-(2,2,2-trifluoroethoxymethyl)benzamide (PubChem CID 55717357) has the molecular formula C19H26F3NO3 and a molecular weight of 373.42 g/mol. Its IUPAC name is N-[2-(2-methylcyclohexyl)oxyethyl]-4-(2,2,2-trifluoroethoxymethyl)benzamide.
| Compound Name | N-[2-(2-methylcyclohexyl)oxyethyl]-4-(2,2,2-trifluoroethoxymethyl)benzamide |
|---|---|
| PubChem CID | 55717357 |
| Molecular Formula | C19H26F3NO3 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | N-[2-(2-methylcyclohexyl)oxyethyl]-4-(2,2,2-trifluoroethoxymethyl)benzamide |
| SMILES | CC1CCCCC1OCCNC(=O)c1ccc(COCC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H26F3NO3/c1-14-4-2-3-5-17(14)26-11-10-23-18(24)16-8-6-15(7-9-16)12-25-13-19(20,21)22/h6-9,14,17H,2-5,10-13H2,1H3,(H,23,24) |
| InChIKey | MSSZSVYQGAWJEU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|