C18H27NO3 — CID 51726082
3-(methoxymethyl)-N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]benzamide (PubChem CID 51726082) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is 3-(methoxymethyl)-N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]benzamide.
| Compound Name | 3-(methoxymethyl)-N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]benzamide |
|---|---|
| PubChem CID | 51726082 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 3-(methoxymethyl)-N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]benzamide |
| SMILES | COCc1cccc(C(=O)NCCO[C@H]2CCCC[C@H]2C)c1 |
| InChI | InChI=1S/C18H27NO3/c1-14-6-3-4-9-17(14)22-11-10-19-18(20)16-8-5-7-15(12-16)13-21-2/h5,7-8,12,14,17H,3-4,6,9-11,13H2,1-2H3,(H,19,20)/t14-,17+/m1/s1 |
| InChIKey | HWIDVVGLWNINEZ-PBHICJAKSA-N |
| XLogP | 3.16 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|