C20H30N4O2 — CID 71886952
5-(2,5-dimethylpyrrol-1-yl)-1-methyl-N-[2-(2-methylcyclohexyl)oxyethyl]pyrazole-4-carboxamide (PubChem CID 71886952) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 5-(2,5-dimethylpyrrol-1-yl)-1-methyl-N-[2-(2-methylcyclohexyl)oxyethyl]pyrazole-4-carboxamide.
| Compound Name | 5-(2,5-dimethylpyrrol-1-yl)-1-methyl-N-[2-(2-methylcyclohexyl)oxyethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 71886952 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 5-(2,5-dimethylpyrrol-1-yl)-1-methyl-N-[2-(2-methylcyclohexyl)oxyethyl]pyrazole-4-carboxamide |
| SMILES | Cc1ccc(C)n1-c1c(C(=O)NCCOC2CCCCC2C)cnn1C |
| InChI | InChI=1S/C20H30N4O2/c1-14-7-5-6-8-18(14)26-12-11-21-19(25)17-13-22-23(4)20(17)24-15(2)9-10-16(24)3/h9-10,13-14,18H,5-8,11-12H2,1-4H3,(H,21,25) |
| InChIKey | SINDZENLNQYVPI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|