C19H25BrN2O2 — CID 52538277
3-bromo-1-methyl-N-[2-[(1R,2S)-2-methylcyclohexyl]oxyethyl]indole-2-carboxamide (PubChem CID 52538277) has the molecular formula C19H25BrN2O2 and a molecular weight of 393.33 g/mol. Its IUPAC name is 3-bromo-1-methyl-N-[2-[(1R,2S)-2-methylcyclohexyl]oxyethyl]indole-2-carboxamide.
| Compound Name | 3-bromo-1-methyl-N-[2-[(1R,2S)-2-methylcyclohexyl]oxyethyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 52538277 |
| Molecular Formula | C19H25BrN2O2 |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 3-bromo-1-methyl-N-[2-[(1R,2S)-2-methylcyclohexyl]oxyethyl]indole-2-carboxamide |
| SMILES | C[C@H]1CCCC[C@H]1OCCNC(=O)c1c(Br)c2ccccc2n1C |
| InChI | InChI=1S/C19H25BrN2O2/c1-13-7-3-6-10-16(13)24-12-11-21-19(23)18-17(20)14-8-4-5-9-15(14)22(18)2/h4-5,8-9,13,16H,3,6-7,10-12H2,1-2H3,(H,21,23)/t13-,16+/m0/s1 |
| InChIKey | ZAKASKXJXLVQEY-XJKSGUPXSA-N |
| XLogP | 4.27 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|