C19H24N2O3 — CID 94121849
N-[2-[(1R,2S)-2-methylcyclohexyl]oxyethyl]-1-oxo-2H-isoquinoline-3-carboxamide (PubChem CID 94121849) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-[2-[(1R,2S)-2-methylcyclohexyl]oxyethyl]-1-oxo-2H-isoquinoline-3-carboxamide.
| Compound Name | N-[2-[(1R,2S)-2-methylcyclohexyl]oxyethyl]-1-oxo-2H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 94121849 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-[2-[(1R,2S)-2-methylcyclohexyl]oxyethyl]-1-oxo-2H-isoquinoline-3-carboxamide |
| SMILES | C[C@H]1CCCC[C@H]1OCCNC(=O)c1cc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H24N2O3/c1-13-6-2-5-9-17(13)24-11-10-20-19(23)16-12-14-7-3-4-8-15(14)18(22)21-16/h3-4,7-8,12-13,17H,2,5-6,9-11H2,1H3,(H,20,23)(H,21,22)/t13-,17+/m0/s1 |
| InChIKey | HYKLCSVSIYARRJ-SUMWQHHRSA-N |
| XLogP | 2.85 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|