C19H24N2O4 — CID 95977413
6-(furan-2-yl)-N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 95977413) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 6-(furan-2-yl)-N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 6-(furan-2-yl)-N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 95977413 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 6-(furan-2-yl)-N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | C[C@@H]1CCCC[C@@H]1OCCNC(=O)c1ccc(-c2ccco2)[nH]c1=O |
| InChI | InChI=1S/C19H24N2O4/c1-13-5-2-3-6-16(13)25-12-10-20-18(22)14-8-9-15(21-19(14)23)17-7-4-11-24-17/h4,7-9,11,13,16H,2-3,5-6,10,12H2,1H3,(H,20,22)(H,21,23)/t13-,16+/m1/s1 |
| InChIKey | KXZXNONWCYOMEC-CJNGLKHVSA-N |
| XLogP | 2.96 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|