C21H27N3O4 — CID 47034767
N-[3-[2-(2-methylcyclohexyl)oxyethylcarbamoylamino]phenyl]furan-2-carboxamide (PubChem CID 47034767) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[3-[2-(2-methylcyclohexyl)oxyethylcarbamoylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-(2-methylcyclohexyl)oxyethylcarbamoylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 47034767 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-[3-[2-(2-methylcyclohexyl)oxyethylcarbamoylamino]phenyl]furan-2-carboxamide |
| SMILES | CC1CCCCC1OCCNC(=O)Nc1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C21H27N3O4/c1-15-6-2-3-9-18(15)28-13-11-22-21(26)24-17-8-4-7-16(14-17)23-20(25)19-10-5-12-27-19/h4-5,7-8,10,12,14-15,18H,2-3,6,9,11,13H2,1H3,(H,23,25)(H2,22,24,26) |
| InChIKey | GOUUIZXJRDKHKS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|