C21H31N3O4 — CID 124727206
(2R)-N-[4-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylcarbamoylamino]phenyl]oxolane-2-carboxamide (PubChem CID 124727206) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is (2R)-N-[4-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylcarbamoylamino]phenyl]oxolane-2-carboxamide.
| Compound Name | (2R)-N-[4-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylcarbamoylamino]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 124727206 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | (2R)-N-[4-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylcarbamoylamino]phenyl]oxolane-2-carboxamide |
| SMILES | C[C@@H]1CCCC[C@@H]1OCCNC(=O)Nc1ccc(NC(=O)[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C21H31N3O4/c1-15-5-2-3-6-18(15)28-14-12-22-21(26)24-17-10-8-16(9-11-17)23-20(25)19-7-4-13-27-19/h8-11,15,18-19H,2-7,12-14H2,1H3,(H,23,25)(H2,22,24,26)/t15-,18+,19-/m1/s1 |
| InChIKey | CSCFBJJARIRYTK-AYOQOUSVSA-N |
| XLogP | 3.52 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|