C20H27N3O2 — CID 86990919
N-[4-(4-methylpiperidin-1-yl)butyl]-1-oxo-2H-isoquinoline-3-carboxamide (PubChem CID 86990919) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is N-[4-(4-methylpiperidin-1-yl)butyl]-1-oxo-2H-isoquinoline-3-carboxamide.
| Compound Name | N-[4-(4-methylpiperidin-1-yl)butyl]-1-oxo-2H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 86990919 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N-[4-(4-methylpiperidin-1-yl)butyl]-1-oxo-2H-isoquinoline-3-carboxamide |
| SMILES | CC1CCN(CCCCNC(=O)c2cc3ccccc3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C20H27N3O2/c1-15-8-12-23(13-9-15)11-5-4-10-21-20(25)18-14-16-6-2-3-7-17(16)19(24)22-18/h2-3,6-7,14-15H,4-5,8-13H2,1H3,(H,21,25)(H,22,24) |
| InChIKey | VDZWAMBEANTQAI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|