C15H24N4O2S — CID 51946372
1-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]urea (PubChem CID 51946372) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]urea.
| Compound Name | 1-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]urea |
|---|---|
| PubChem CID | 51946372 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]urea |
| SMILES | C[C@@H]1CCCC[C@H]1OCCNC(=O)Nc1nnc(C2CC2)s1 |
| InChI | InChI=1S/C15H24N4O2S/c1-10-4-2-3-5-12(10)21-9-8-16-14(20)17-15-19-18-13(22-15)11-6-7-11/h10-12H,2-9H2,1H3,(H2,16,17,19,20)/t10-,12-/m1/s1 |
| InChIKey | XIATYTRNVGPZNN-ZYHUDNBSSA-N |
| XLogP | 3.13 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|