C16H26N2O3S — CID 99846608
1-[(2R)-2-hydroxy-2-thiophen-2-ylethyl]-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]urea (PubChem CID 99846608) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxy-2-thiophen-2-ylethyl]-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]urea.
| Compound Name | 1-[(2R)-2-hydroxy-2-thiophen-2-ylethyl]-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]urea |
|---|---|
| PubChem CID | 99846608 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1-[(2R)-2-hydroxy-2-thiophen-2-ylethyl]-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]urea |
| SMILES | C[C@@H]1CCCC[C@@H]1OCCNC(=O)NC[C@@H](O)c1cccs1 |
| InChI | InChI=1S/C16H26N2O3S/c1-12-5-2-3-6-14(12)21-9-8-17-16(20)18-11-13(19)15-7-4-10-22-15/h4,7,10,12-14,19H,2-3,5-6,8-9,11H2,1H3,(H2,17,18,20)/t12-,13-,14+/m1/s1 |
| InChIKey | XUJXBNYWKXQNEE-MCIONIFRSA-N |
| XLogP | 2.68 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|