C6H6F6N2O3 — CID 175955697
2,2,2-trifluoroethylcarbamoyl N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 175955697) has the molecular formula C6H6F6N2O3 and a molecular weight of 268.11 g/mol. Its IUPAC name is 2,2,2-trifluoroethylcarbamoyl N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | 2,2,2-trifluoroethylcarbamoyl N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 175955697 |
| Molecular Formula | C6H6F6N2O3 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 2,2,2-trifluoroethylcarbamoyl N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | O=C(NCC(F)(F)F)OC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H6F6N2O3/c7-5(8,9)1-13-3(15)17-4(16)14-2-6(10,11)12/h1-2H2,(H,13,15)(H,14,16) |
| InChIKey | GDCPLKJCUDOROG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|